C20H19N3O7 — CID 8887436
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 8887436) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8887436 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1coc2cc(O)ccc12)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O7/c24-16-5-6-17-13(11-29-18(17)10-16)9-20(26)30-12-19(25)22-8-7-21-14-1-3-15(4-2-14)23(27)28/h1-6,10-11,21,24H,7-9,12H2,(H,22,25) |
| InChIKey | DHODEQOYWRVDOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|