C18H14FNO5 — CID 7415410
[2-(4-fluoroanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7415410) has the molecular formula C18H14FNO5 and a molecular weight of 343.31 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7415410 |
| Molecular Formula | C18H14FNO5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1coc2cc(O)ccc12)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO5/c19-12-1-3-13(4-2-12)20-17(22)10-25-18(23)7-11-9-24-16-8-14(21)5-6-15(11)16/h1-6,8-9,21H,7,10H2,(H,20,22) |
| InChIKey | WKEBGGVFRFRKSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |