C19H17NO6 — CID 7807175
[2-(4-methoxyanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7807175) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7807175 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cc2coc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C19H17NO6/c1-24-15-5-2-13(3-6-15)20-18(22)11-26-19(23)8-12-10-25-17-9-14(21)4-7-16(12)17/h2-7,9-10,21H,8,11H2,1H3,(H,20,22) |
| InChIKey | AMXZCJYEXVCKHD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |