C20H18ClNO6 — CID 8887363
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 8887363) has the molecular formula C20H18ClNO6 and a molecular weight of 403.82 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8887363 |
| Molecular Formula | C20H18ClNO6 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1coc2cc(O)ccc12)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO6/c21-14-1-4-16(5-2-14)26-8-7-22-19(24)12-28-20(25)9-13-11-27-18-10-15(23)3-6-17(13)18/h1-6,10-11,23H,7-9,12H2,(H,22,24) |
| InChIKey | MIBDYFAJYUEDQZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|