C21H20N2O6 — CID 8525096
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 8525096) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8525096 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)OCC(=O)Nc3c([N+](=O)[O-])ccc(C)c3C)coc2c1 |
| InChI | InChI=1S/C21H20N2O6/c1-12-4-6-16-15(10-28-18(16)8-12)9-20(25)29-11-19(24)22-21-14(3)13(2)5-7-17(21)23(26)27/h4-8,10H,9,11H2,1-3H3,(H,22,24) |
| InChIKey | PFLIQEWXQJWQKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|