C18H17ClN2O5 — CID 8631755
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate (PubChem CID 8631755) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8631755 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(2-chlorophenyl)acetate |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C18H17ClN2O5/c1-11-7-8-15(21(24)25)18(12(11)2)20-16(22)10-26-17(23)9-13-5-3-4-6-14(13)19/h3-8H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | OVRQBOHDNCYYBU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|