C21H24N2O6 — CID 8731416
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 3-(2-ethoxyphenyl)propanoate (PubChem CID 8731416) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 3-(2-ethoxyphenyl)propanoate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 3-(2-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 8731416 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 3-(2-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccccc1CCC(=O)OCC(=O)Nc1c([N+](=O)[O-])ccc(C)c1C |
| InChI | InChI=1S/C21H24N2O6/c1-4-28-18-8-6-5-7-16(18)10-12-20(25)29-13-19(24)22-21-15(3)14(2)9-11-17(21)23(26)27/h5-9,11H,4,10,12-13H2,1-3H3,(H,22,24) |
| InChIKey | CHHRMLUHVBPEQP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|