C17H17N3O7 — CID 7879506
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7879506) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7879506 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)CNC(=O)c2ccco2)c1C |
| InChI | InChI=1S/C17H17N3O7/c1-10-5-6-12(20(24)25)16(11(10)2)19-14(21)9-27-15(22)8-18-17(23)13-4-3-7-26-13/h3-7H,8-9H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | VFDUUUJNNFXQRA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|