C18H19N3O7 — CID 7571064
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 7571064) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 7571064 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)[C@H](C)NC(=O)c2ccco2)c1C |
| InChI | InChI=1S/C18H19N3O7/c1-10-6-7-13(21(25)26)16(11(10)2)20-15(22)9-28-18(24)12(3)19-17(23)14-5-4-8-27-14/h4-8,12H,9H2,1-3H3,(H,19,23)(H,20,22)/t12-/m0/s1 |
| InChIKey | SHPPIKNGBVMIAS-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|