C15H14ClN3O5 — CID 7570973
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 7570973) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 7570973 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H14ClN3O5/c1-9(18-14(21)11-5-3-7-23-11)15(22)24-8-12(20)19-10-4-2-6-17-13(10)16/h2-7,9H,8H2,1H3,(H,18,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | IPEHAUYTMAMPAD-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|