C16H15ClN4O6 — CID 8875456
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate (PubChem CID 8875456) has the molecular formula C16H15ClN4O6 and a molecular weight of 394.77 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 8875456 |
| Molecular Formula | C16H15ClN4O6 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1ccco1)NCC(=O)OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H15ClN4O6/c17-15-10(3-1-5-18-15)21-13(23)9-27-14(24)8-19-12(22)7-20-16(25)11-4-2-6-26-11/h1-6H,7-9H2,(H,19,22)(H,20,25)(H,21,23) |
| InChIKey | IVARUFWSCZJICY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 139.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|