C17H17ClN2O6 — CID 8875533
2-(4-chlorophenoxy)ethyl 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate (PubChem CID 8875533) has the molecular formula C17H17ClN2O6 and a molecular weight of 380.78 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 8875533 |
| Molecular Formula | C17H17ClN2O6 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1ccco1)NCC(=O)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O6/c18-12-3-5-13(6-4-12)24-8-9-26-16(22)11-19-15(21)10-20-17(23)14-2-1-7-25-14/h1-7H,8-11H2,(H,19,21)(H,20,23) |
| InChIKey | JPSLEQYOLFIVFR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|