C20H16ClN3O4 — CID 7881074
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate (PubChem CID 7881074) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7881074 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc2ccccc2c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C20H16ClN3O4/c21-19-16(6-3-9-22-19)24-17(25)12-28-18(26)11-23-20(27)15-8-7-13-4-1-2-5-14(13)10-15/h1-10H,11-12H2,(H,23,27)(H,24,25) |
| InChIKey | YPXZRLOUDXKNIB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|