C16H13ClN4O5S — CID 7653227
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate (PubChem CID 7653227) has the molecular formula C16H13ClN4O5S and a molecular weight of 408.82 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7653227 |
| Molecular Formula | C16H13ClN4O5S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCC(=O)OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H13ClN4O5S/c17-16-12(5-3-7-19-16)21-14(22)10-26-15(23)9-20-27(24,25)13-6-2-1-4-11(13)8-18/h1-7,20H,9-10H2,(H,21,22) |
| InChIKey | OCORWINMCYJENU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|