C16H21N3O5S — CID 7653300
[2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate (PubChem CID 7653300) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7653300 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
| SMILES | CC(C)[C@H](C)NC(=O)COC(=O)CNS(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C16H21N3O5S/c1-11(2)12(3)19-15(20)10-24-16(21)9-18-25(22,23)14-7-5-4-6-13(14)8-17/h4-7,11-12,18H,9-10H2,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | TUQGCIPYEHDHCN-LBPRGKRZSA-N |
| XLogP | 0.54 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |