C15H12Cl3N3O5S — CID 2394798
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate (PubChem CID 2394798) has the molecular formula C15H12Cl3N3O5S and a molecular weight of 452.70 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 2394798 |
| Molecular Formula | C15H12Cl3N3O5S |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 450.96 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1c(Cl)cccc1Cl)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H12Cl3N3O5S/c16-9-3-1-4-10(17)14(9)27(24,25)20-7-13(23)26-8-12(22)21-11-5-2-6-19-15(11)18/h1-6,20H,7-8H2,(H,21,22) |
| InChIKey | SDOSBNRTRSQAPT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|