C20H24Cl2N2O5S — CID 5136497
[2-(1-adamantylamino)-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate (PubChem CID 5136497) has the molecular formula C20H24Cl2N2O5S and a molecular weight of 475.39 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 5136497 |
| Molecular Formula | C20H24Cl2N2O5S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 2-[(2,6-dichlorophenyl)sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1c(Cl)cccc1Cl)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24Cl2N2O5S/c21-15-2-1-3-16(22)19(15)30(27,28)23-10-18(26)29-11-17(25)24-20-7-12-4-13(8-20)6-14(5-12)9-20/h1-3,12-14,23H,4-11H2,(H,24,25) |
| InChIKey | CMPKUDCWKRUFGC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |