C24H28N2O6S — CID 4310598
[2-(1-adamantylamino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 4310598) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4310598 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H28N2O6S/c27-22(26-24-11-16-8-17(12-24)10-18(9-16)13-24)15-32-23(28)19-3-5-21(6-4-19)33(29,30)25-14-20-2-1-7-31-20/h1-7,16-18,25H,8-15H2,(H,26,27) |
| InChIKey | ZHFKTARNMRBSKQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |