C24H23N3O7S — CID 16526919
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 16526919) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16526919 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C24H23N3O7S/c28-22(27-21-6-2-1-5-20(21)23(29)26-17-9-10-17)15-34-24(30)16-7-11-19(12-8-16)35(31,32)25-14-18-4-3-13-33-18/h1-8,11-13,17,25H,9-10,14-15H2,(H,26,29)(H,27,28) |
| InChIKey | ODHWEEKEQVNLRY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |