C20H16ClFN2O6S — CID 16526843
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 16526843) has the molecular formula C20H16ClFN2O6S and a molecular weight of 466.87 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16526843 |
| Molecular Formula | C20H16ClFN2O6S |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C20H16ClFN2O6S/c21-14-5-8-17(22)18(10-14)24-19(25)12-30-20(26)13-3-6-16(7-4-13)31(27,28)23-11-15-2-1-9-29-15/h1-10,23H,11-12H2,(H,24,25) |
| InChIKey | KQTQVPSMMGPELC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |