C15H15NO6S — CID 3292841
2-oxopropyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 3292841) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-oxopropyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | 2-oxopropyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3292841 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-oxopropyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(=O)COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C15H15NO6S/c1-11(17)10-22-15(18)12-4-6-14(7-5-12)23(19,20)16-9-13-3-2-8-21-13/h2-8,16H,9-10H2,1H3 |
| InChIKey | LIHOBDSLOOICCM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |