C19H17NO5S — CID 7765854
benzyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 7765854) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is benzyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | benzyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7765854 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | benzyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c21-19(25-14-15-5-2-1-3-6-15)16-8-10-18(11-9-16)26(22,23)20-13-17-7-4-12-24-17/h1-12,20H,13-14H2 |
| InChIKey | WUHHAARXAZJFKO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |