C21H18F2N2O7S — CID 2409383
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2409383) has the molecular formula C21H18F2N2O7S and a molecular weight of 480.45 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2409383 |
| Molecular Formula | C21H18F2N2O7S |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H18F2N2O7S/c22-21(23)32-16-7-5-15(6-8-16)25-19(26)13-31-20(27)14-3-9-18(10-4-14)33(28,29)24-12-17-2-1-11-30-17/h1-11,21,24H,12-13H2,(H,25,26) |
| InChIKey | LEXLLEHZJHHDES-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |