C21H20F2N2O5S — CID 46655328
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 46655328) has the molecular formula C21H20F2N2O5S and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46655328 |
| Molecular Formula | C21H20F2N2O5S |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCCc1ccc(OC(F)F)cc1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H20F2N2O5S/c22-21(23)30-17-7-3-15(4-8-17)11-12-24-20(26)16-5-9-19(10-6-16)31(27,28)25-14-18-2-1-13-29-18/h1-10,13,21,25H,11-12,14H2,(H,24,26) |
| InChIKey | ASRBAHVJLAPQEV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |