C17H19F2N3O4 — CID 51291262
2-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 51291262) has the molecular formula C17H19F2N3O4 and a molecular weight of 367.35 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51291262 |
| Molecular Formula | C17H19F2N3O4 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC(=O)NCCc1ccc(OC(F)F)cc1)NCc1ccco1 |
| InChI | InChI=1S/C17H19F2N3O4/c18-16(19)26-13-5-3-12(4-6-13)7-8-20-17(24)22-11-15(23)21-10-14-2-1-9-25-14/h1-6,9,16H,7-8,10-11H2,(H,21,23)(H2,20,22,24) |
| InChIKey | KZNGRIRGIDELOW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |