C17H22N2O5 — CID 113217080
1-(furan-2-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217080) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217080 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(CCNC(=O)NCc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O5/c1-21-14-9-12(10-15(22-2)16(14)23-3)6-7-18-17(20)19-11-13-5-4-8-24-13/h4-5,8-10H,6-7,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | RYBSIMGWKFSGAW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |