C20H25FN2O4 — CID 113217101
1-[2-(4-fluorophenyl)ethyl]-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217101) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217101 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(CCNC(=O)NCCc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25FN2O4/c1-25-17-12-15(13-18(26-2)19(17)27-3)9-11-23-20(24)22-10-8-14-4-6-16(21)7-5-14/h4-7,12-13H,8-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | VLWPNJFHFDPHBN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |