C19H23FN2O4 — CID 55482057
1-[2-(2-fluorophenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]urea (PubChem CID 55482057) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 55482057 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
| SMILES | COc1cc(CNC(=O)NCCc2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C19H23FN2O4/c1-24-16-10-13(11-17(25-2)18(16)26-3)12-22-19(23)21-9-8-14-6-4-5-7-15(14)20/h4-7,10-11H,8-9,12H2,1-3H3,(H2,21,22,23) |
| InChIKey | GTAQHYRJLPDLNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |