C24H28FNO6 — CID 71562289
cis-ethyl (1S,2S)-1-[2-(2-fluorophenyl)ethylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 71562289) has the molecular formula C24H28FNO6 and a molecular weight of 445.49 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-1-[2-(2-fluorophenyl)ethylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-1-[2-(2-fluorophenyl)ethylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71562289 |
| Molecular Formula | C24H28FNO6 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | cis-ethyl (1S,2S)-1-[2-(2-fluorophenyl)ethylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(=O)NCCc2ccccc2F)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H28FNO6/c1-5-32-23(28)24(22(27)26-11-10-15-8-6-7-9-18(15)25)14-17(24)16-12-19(29-2)21(31-4)20(13-16)30-3/h6-9,12-13,17H,5,10-11,14H2,1-4H3,(H,26,27)/t17-,24-/m0/s1 |
| InChIKey | RGEJLLUAOKLHFK-XDHUDOTRSA-N |
| XLogP | 3.25 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|