C22H24ClNO6 — CID 71720434
ethyl 1-[(2-chlorophenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 71720434) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is ethyl 1-[(2-chlorophenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(2-chlorophenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71720434 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl 1-[(2-chlorophenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)Nc2ccccc2Cl)CC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H24ClNO6/c1-5-30-21(26)22(20(25)24-16-9-7-6-8-15(16)23)12-14(22)13-10-17(27-2)19(29-4)18(11-13)28-3/h6-11,14H,5,12H2,1-4H3,(H,24,25) |
| InChIKey | LUXJCQJRSKGJIV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|