C20H17F3N2O5 — CID 86304821
ethyl 1-[(2-nitrophenyl)carbamoyl]-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 86304821) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is ethyl 1-[(2-nitrophenyl)carbamoyl]-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(2-nitrophenyl)carbamoyl]-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86304821 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl 1-[(2-nitrophenyl)carbamoyl]-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)Nc2ccccc2[N+](=O)[O-])CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O5/c1-2-30-18(27)19(17(26)24-15-5-3-4-6-16(15)25(28)29)11-14(19)12-7-9-13(10-8-12)20(21,22)23/h3-10,14H,2,11H2,1H3,(H,24,26) |
| InChIKey | TZAZWPZBVRGSLZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|