C17H21NO3 — CID 44557722
cis-ethyl (1R,2R)-2-phenyl-1-(pyrrolidine-1-carbonyl)cyclopropane-1-carboxylate (PubChem CID 44557722) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-2-phenyl-1-(pyrrolidine-1-carbonyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-2-phenyl-1-(pyrrolidine-1-carbonyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 44557722 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | cis-ethyl (1R,2R)-2-phenyl-1-(pyrrolidine-1-carbonyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(=O)N2CCCC2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-2-21-16(20)17(15(19)18-10-6-7-11-18)12-14(17)13-8-4-3-5-9-13/h3-5,8-9,14H,2,6-7,10-12H2,1H3/t14-,17-/m1/s1 |
| InChIKey | VVAHFUFVWUSQNK-RHSMWYFYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|