C15H20O2 — CID 101471522
cis-ethyl (1S,2R)-2-phenyl-1-propylcyclopropane-1-carboxylate (PubChem CID 101471522) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-phenyl-1-propylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-phenyl-1-propylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101471522 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | cis-ethyl (1S,2R)-2-phenyl-1-propylcyclopropane-1-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-3-10-15(14(16)17-4-2)11-13(15)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | CSRMEQHLVRPMRH-HIFRSBDPSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |