C12H13ClO2 — CID 25137557
cis-ethyl (1R,2R)-1-chloro-2-phenylcyclopropane-1-carboxylate (PubChem CID 25137557) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-chloro-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-chloro-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 25137557 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | cis-ethyl (1R,2R)-1-chloro-2-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cl)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H13ClO2/c1-2-15-11(14)12(13)8-10(12)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/t10-,12-/m1/s1 |
| InChIKey | YAPAIZXHAMYBHW-ZYHUDNBSSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|