C18H21ClO6 — CID 12009005
triethyl 2-chloro-3-phenylcyclopropane-1,1,2-tricarboxylate (PubChem CID 12009005) has the molecular formula C18H21ClO6 and a molecular weight of 368.81 g/mol. Its IUPAC name is triethyl 2-chloro-3-phenylcyclopropane-1,1,2-tricarboxylate.
| Compound Name | triethyl 2-chloro-3-phenylcyclopropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 12009005 |
| Molecular Formula | C18H21ClO6 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | triethyl 2-chloro-3-phenylcyclopropane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C1(Cl)C(c2ccccc2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H21ClO6/c1-4-23-14(20)17(15(21)24-5-2)13(12-10-8-7-9-11-12)18(17,19)16(22)25-6-3/h7-11,13H,4-6H2,1-3H3 |
| InChIKey | WFFNTHTYTKAMPK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|