C46H46N2O8 — CID 73212303
tetraethyl 3,6,9,12-tetraphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate (PubChem CID 73212303) has the molecular formula C46H46N2O8 and a molecular weight of 754.88 g/mol. Its IUPAC name is tetraethyl 3,6,9,12-tetraphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate.
| Compound Name | tetraethyl 3,6,9,12-tetraphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate |
|---|---|
| PubChem CID | 73212303 |
| Molecular Formula | C46H46N2O8 |
| Molecular Weight | 754.88 g/mol |
| Exact Mass | 754.33 |
| IUPAC Name | tetraethyl 3,6,9,12-tetraphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate |
| SMILES | CCOC(=O)C12C(c3ccccc3)C3(C(=O)OCC)C4N(c5ccccc5)C1C1(C(=O)OCC)C(c5ccccc5)C4(C(=O)OCC)C3N(c3ccccc3)C21 |
| InChI | InChI=1S/C46H46N2O8/c1-5-53-39(49)43-33(29-21-13-9-14-22-29)44(40(50)54-6-2)37-46(42(52)56-8-4)34(30-23-15-10-16-24-30)45(41(51)55-7-3,35(43)47(37)31-25-17-11-18-26-31)36(43)48(38(44)46)32-27-19-12-20-28-32/h9-28,33-38H,5-8H2,1-4H3 |
| InChIKey | QMRDVRMJEIIONX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|