C20H19NO4 — CID 14868335
ethyl (2S,3R)-3-methyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate (PubChem CID 14868335) has the molecular formula C20H19NO4 and a molecular weight of 338.37 g/mol. Its IUPAC name is ethyl (2S,3R)-3-methyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3R)-3-methyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 14868335 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl (2S,3R)-3-methyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate |
| SMILES | CCO[13C](=O)[C@@]1(C)C(=O)C(=O)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-3-25-19(24)20(2)16(14-10-6-4-7-11-14)21(18(23)17(20)22)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3/t16-,20+/m0/s1/i19+1 |
| InChIKey | MMXQYAFKZXRKPF-HDHYWRIHSA-N |
| XLogP | 2.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|