C33H28BrNO4 — CID 11734575
ethyl 3-benzhydryl-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate (PubChem CID 11734575) has the molecular formula C33H28BrNO4 and a molecular weight of 582.49 g/mol. Its IUPAC name is ethyl 3-benzhydryl-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-benzhydryl-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11734575 |
| Molecular Formula | C33H28BrNO4 |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | ethyl 3-benzhydryl-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C(c2ccccc2)c2ccccc2)C(=O)C(=O)N(c2ccc(C)cc2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C33H28BrNO4/c1-3-39-32(38)33(28(23-10-6-4-7-11-23)24-12-8-5-9-13-24)29(25-16-18-26(34)19-17-25)35(31(37)30(33)36)27-20-14-22(2)15-21-27/h4-21,28-29H,3H2,1-2H3 |
| InChIKey | SIDOHQFDUJUXIR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|