C20H18BrNO4 — CID 7562218
ethyl (2R,3R)-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate (PubChem CID 7562218) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7562218 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | ethyl (2R,3R)-2-(4-bromophenyl)-1-(4-methylphenyl)-4,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C(=O)N(c2ccc(C)cc2)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrNO4/c1-3-26-20(25)16-17(13-6-8-14(21)9-7-13)22(19(24)18(16)23)15-10-4-12(2)5-11-15/h4-11,16-17H,3H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | AXRKTXOAZUQRPR-SJORKVTESA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|