C19H17N3O8S — CID 6584478
ethyl (2R,3S)-2-(4-nitrophenyl)-4,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylate (PubChem CID 6584478) has the molecular formula C19H17N3O8S and a molecular weight of 447.43 g/mol. Its IUPAC name is ethyl (2R,3S)-2-(4-nitrophenyl)-4,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl (2R,3S)-2-(4-nitrophenyl)-4,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 6584478 |
| Molecular Formula | C19H17N3O8S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | ethyl (2R,3S)-2-(4-nitrophenyl)-4,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C(=O)N(c2ccc(S(N)(=O)=O)cc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N3O8S/c1-2-30-19(25)15-16(11-3-5-13(6-4-11)22(26)27)21(18(24)17(15)23)12-7-9-14(10-8-12)31(20,28)29/h3-10,15-16H,2H2,1H3,(H2,20,28,29)/t15-,16-/m0/s1 |
| InChIKey | XXBUXBOULOWDQU-HOTGVXAUSA-N |
| XLogP | 1.08 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|