C19H15FN2O6 — CID 7561891
ethyl (2S,3R)-2-(2-fluorophenyl)-1-(4-nitrophenyl)-4,5-dioxopyrrolidine-3-carboxylate (PubChem CID 7561891) has the molecular formula C19H15FN2O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is ethyl (2S,3R)-2-(2-fluorophenyl)-1-(4-nitrophenyl)-4,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3R)-2-(2-fluorophenyl)-1-(4-nitrophenyl)-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7561891 |
| Molecular Formula | C19H15FN2O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | ethyl (2S,3R)-2-(2-fluorophenyl)-1-(4-nitrophenyl)-4,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C(=O)N(c2ccc([N+](=O)[O-])cc2)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C19H15FN2O6/c1-2-28-19(25)15-16(13-5-3-4-6-14(13)20)21(18(24)17(15)23)11-7-9-12(10-8-11)22(26)27/h3-10,15-16H,2H2,1H3/t15-,16-/m1/s1 |
| InChIKey | IVHOGLRMTRHDKK-HZPDHXFCSA-N |
| XLogP | 2.57 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|