C19H17N3O8S — CID 54686983
ethyl 4-hydroxy-2-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate (PubChem CID 54686983) has the molecular formula C19H17N3O8S and a molecular weight of 447.43 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54686983 |
| Molecular Formula | C19H17N3O8S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | ethyl 4-hydroxy-2-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O8S/c1-2-30-19(25)15-16(11-4-3-5-13(10-11)22(26)27)21(18(24)17(15)23)12-6-8-14(9-7-12)31(20,28)29/h3-10,16,23H,2H2,1H3,(H2,20,28,29) |
| InChIKey | JEWNYWIRCXUNKJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|