C19H15ClFNO4 — CID 69499183
ethyl 1-(4-chlorophenyl)-2-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 69499183) has the molecular formula C19H15ClFNO4 and a molecular weight of 375.78 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-2-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)-2-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 69499183 |
| Molecular Formula | C19H15ClFNO4 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-2-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(c2ccc(Cl)cc2)C1c1cccc(F)c1 |
| InChI | InChI=1S/C19H15ClFNO4/c1-2-26-19(25)15-16(11-4-3-5-13(21)10-11)22(18(24)17(15)23)14-8-6-12(20)7-9-14/h3-10,16,23H,2H2,1H3 |
| InChIKey | PJLMLVDTJIIPRZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |