C20H20N2O7S — CID 54676164
ethyl 4-hydroxy-2-(4-methoxyphenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate (PubChem CID 54676164) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-(4-methoxyphenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-(4-methoxyphenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54676164 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | ethyl 4-hydroxy-2-(4-methoxyphenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20N2O7S/c1-3-29-20(25)16-17(12-4-8-14(28-2)9-5-12)22(19(24)18(16)23)13-6-10-15(11-7-13)30(21,26)27/h4-11,17,23H,3H2,1-2H3,(H2,21,26,27) |
| InChIKey | BSHMBAHJMWWVFR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |