C25H24N2O4 — CID 123456644
4-(2,2-dimethylpropanoyl)-5-(4-methylphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 123456644) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-5-(4-methylphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-5-(4-methylphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123456644 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-5-(4-methylphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C2C(C(=O)C(C)(C)C)C(=O)C(=O)N2c2ccc(-c3ccon3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-15-5-7-17(8-6-15)21-20(23(29)25(2,3)4)22(28)24(30)27(21)18-11-9-16(10-12-18)19-13-14-31-26-19/h5-14,20-21H,1-4H3 |
| InChIKey | INLYFZRHSWYMSH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|