C23H20FNO3 — CID 123727211
4-(2,2-dimethylpropanoyl)-1-(4-ethynylphenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 123727211) has the molecular formula C23H20FNO3 and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-(4-ethynylphenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-(4-ethynylphenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123727211 |
| Molecular Formula | C23H20FNO3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-(4-ethynylphenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | C#Cc1ccc(N2C(=O)C(=O)C(C(=O)C(C)(C)C)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H20FNO3/c1-5-14-6-12-17(13-7-14)25-19(15-8-10-16(24)11-9-15)18(20(26)22(25)28)21(27)23(2,3)4/h1,6-13,18-19H,2-4H3 |
| InChIKey | AYTRKARXBYQYKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|