C25H24N2O4S — CID 123785757
4-(2,2-dimethylpropanoyl)-5-(2-methoxyphenyl)-1-[4-(1,3-thiazol-2-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 123785757) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-5-(2-methoxyphenyl)-1-[4-(1,3-thiazol-2-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-5-(2-methoxyphenyl)-1-[4-(1,3-thiazol-2-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123785757 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-5-(2-methoxyphenyl)-1-[4-(1,3-thiazol-2-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccccc1C1C(C(=O)C(C)(C)C)C(=O)C(=O)N1c1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-25(2,3)22(29)19-20(17-7-5-6-8-18(17)31-4)27(24(30)21(19)28)16-11-9-15(10-12-16)23-26-13-14-32-23/h5-14,19-20H,1-4H3 |
| InChIKey | UFNNAHFYCAATGT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|