C27H23FN2O5 — CID 123888194
5-(4-fluorophenyl)-1-[4-[1-(methoxyamino)ethenyl]phenyl]-4-(4-methoxybenzoyl)pyrrolidine-2,3-dione (PubChem CID 123888194) has the molecular formula C27H23FN2O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-[4-[1-(methoxyamino)ethenyl]phenyl]-4-(4-methoxybenzoyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-fluorophenyl)-1-[4-[1-(methoxyamino)ethenyl]phenyl]-4-(4-methoxybenzoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123888194 |
| Molecular Formula | C27H23FN2O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 5-(4-fluorophenyl)-1-[4-[1-(methoxyamino)ethenyl]phenyl]-4-(4-methoxybenzoyl)pyrrolidine-2,3-dione |
| SMILES | C=C(NOC)c1ccc(N2C(=O)C(=O)C(C(=O)c3ccc(OC)cc3)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H23FN2O5/c1-16(29-35-3)17-6-12-21(13-7-17)30-24(18-4-10-20(28)11-5-18)23(26(32)27(30)33)25(31)19-8-14-22(34-2)15-9-19/h4-15,23-24,29H,1H2,2-3H3 |
| InChIKey | VMKOIMPIUWCBEZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|