C24H28FN3O4+2 — CID 4757121
5-(4-fluorophenyl)-4-(4-methoxybenzoyl)-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4757121) has the molecular formula C24H28FN3O4+2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(4-methoxybenzoyl)-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-fluorophenyl)-4-(4-methoxybenzoyl)-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757121 |
| Molecular Formula | C24H28FN3O4+2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(4-methoxybenzoyl)-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CC[NH+]3CC[NH2+]CC3)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H26FN3O4/c1-32-19-8-4-17(5-9-19)22(29)20-21(16-2-6-18(25)7-3-16)28(24(31)23(20)30)15-14-27-12-10-26-11-13-27/h2-9,20-21,26H,10-15H2,1H3/p+2 |
| InChIKey | HEQFRGIZMHSQMK-UHFFFAOYSA-P |
| XLogP | -0.75 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|