C25H28FN2O5+ — CID 4758406
5-(4-fluorophenyl)-4-(4-methoxy-3-methylbenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4758406) has the molecular formula C25H28FN2O5+ and a molecular weight of 455.51 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(4-methoxy-3-methylbenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-fluorophenyl)-4-(4-methoxy-3-methylbenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4758406 |
| Molecular Formula | C25H28FN2O5+ |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(4-methoxy-3-methylbenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CC[NH+]3CCOCC3)C2c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C25H27FN2O5/c1-16-15-18(5-8-20(16)32-2)23(29)21-22(17-3-6-19(26)7-4-17)28(25(31)24(21)30)10-9-27-11-13-33-14-12-27/h3-8,15,21-22H,9-14H2,1-2H3/p+1 |
| InChIKey | CLLNHXJLOMPRPO-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|